C22H22O7 — CID 127034045
2-[(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-yl]acetic acid (PubChem CID 127034045) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-yl]acetic acid.
| Compound Name | 2-[(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 127034045 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-yl]acetic acid |
| SMILES | O=C(O)CC1OC[C@@H](Cc2ccc3c(c2)OCO3)[C@@H]1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H22O7/c23-22(24)9-19-16(6-14-2-4-18-21(8-14)29-12-27-18)15(10-25-19)5-13-1-3-17-20(7-13)28-11-26-17/h1-4,7-8,15-16,19H,5-6,9-12H2,(H,23,24)/t15-,16+,19?/m1/s1 |
| InChIKey | GWEOOHCWMXDNLK-IEAUQHRDSA-N |
| XLogP | 3.04 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |