C38H40O8 — CID 163161355
4-[(1R,2S,3R,4S,5R,6S,9S,10R,11R,12R,13R,14S)-4,13-bis(1,3-benzodioxol-5-ylmethyl)-12-(carboxymethyl)-5-pentacyclo[8.4.2.02,9.03,6.011,14]hexadeca-7,15-dienyl]butanoic acid (PubChem CID 163161355) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is 4-[(1R,2S,3R,4S,5R,6S,9S,10R,11R,12R,13R,14S)-4,13-bis(1,3-benzodioxol-5-ylmethyl)-12-(carboxymethyl)-5-pentacyclo[8.4.2.02,9.03,6.011,14]hexadeca-7,15-dienyl]butanoic acid.
| Compound Name | 4-[(1R,2S,3R,4S,5R,6S,9S,10R,11R,12R,13R,14S)-4,13-bis(1,3-benzodioxol-5-ylmethyl)-12-(carboxymethyl)-5-pentacyclo[8.4.2.02,9.03,6.011,14]hexadeca-7,15-dienyl]butanoic acid |
|---|---|
| PubChem CID | 163161355 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 4-[(1R,2S,3R,4S,5R,6S,9S,10R,11R,12R,13R,14S)-4,13-bis(1,3-benzodioxol-5-ylmethyl)-12-(carboxymethyl)-5-pentacyclo[8.4.2.02,9.03,6.011,14]hexadeca-7,15-dienyl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1[C@@H]2C=C[C@H]3[C@H]4C=C[C@@H]([C@H]3[C@@H]2[C@H]1Cc1ccc2c(c1)OCO2)[C@@H]1[C@H](Cc2ccc3c(c2)OCO3)[C@@H](CC(=O)O)[C@H]41 |
| InChI | InChI=1S/C38H40O8/c39-33(40)3-1-2-21-22-6-7-23-24-8-9-25(35(23)36(22)26(21)12-19-4-10-29-31(14-19)45-17-43-29)38-27(28(37(24)38)16-34(41)42)13-20-5-11-30-32(15-20)46-18-44-30/h4-11,14-15,21-28,35-38H,1-3,12-13,16-18H2,(H,39,40)(H,41,42)/t21-,22-,23-,24+,25-,26-,27+,28+,35-,36-,37-,38+/m0/s1 |
| InChIKey | RDAOBUMGAVJMJG-VEIJKRFUSA-N |
| XLogP | 6.23 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|