C18H10NO8- — CID 71403886
[(4-hydroxy-5,8-dioxonaphthalen-1-yl)-(4-nitrophenyl)methyl] carbonate (PubChem CID 71403886) has the molecular formula C18H10NO8- and a molecular weight of 368.28 g/mol. Its IUPAC name is [(4-hydroxy-5,8-dioxonaphthalen-1-yl)-(4-nitrophenyl)methyl] carbonate.
| Compound Name | [(4-hydroxy-5,8-dioxonaphthalen-1-yl)-(4-nitrophenyl)methyl] carbonate |
|---|---|
| PubChem CID | 71403886 |
| Molecular Formula | C18H10NO8- |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [(4-hydroxy-5,8-dioxonaphthalen-1-yl)-(4-nitrophenyl)methyl] carbonate |
| SMILES | O=C([O-])OC(c1ccc([N+](=O)[O-])cc1)c1ccc(O)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C18H11NO8/c20-12-7-8-14(22)16-13(21)6-5-11(15(12)16)17(27-18(23)24)9-1-3-10(4-2-9)19(25)26/h1-8,17,21H,(H,23,24)/p-1 |
| InChIKey | URIKVUXKDUBSHY-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|