C24H22O3 — CID 71405476
acetic acid;2-ethyl-10-phenylanthracen-9-ol (PubChem CID 71405476) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is acetic acid;2-ethyl-10-phenylanthracen-9-ol.
| Compound Name | acetic acid;2-ethyl-10-phenylanthracen-9-ol |
|---|---|
| PubChem CID | 71405476 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | acetic acid;2-ethyl-10-phenylanthracen-9-ol |
| SMILES | CC(=O)O.CCc1ccc2c(-c3ccccc3)c3ccccc3c(O)c2c1 |
| InChI | InChI=1S/C22H18O.C2H4O2/c1-2-15-12-13-18-20(14-15)22(23)19-11-7-6-10-17(19)21(18)16-8-4-3-5-9-16;1-2(3)4/h3-14,23H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | FUMQWRWJWMSWMH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|