acetic acid;2-ethyl-10-phenylanthracen-9-ol

C24H22O3 — CID 71405476

IUPACacetic acid;2-ethyl-10-phenylanthracen-9-ol
SMILESCC(=O)O.CCc1ccc2c(-c3ccccc3)c3ccccc3c(O)c2c1
InChIInChI=1S/C22H18O.C2H4O2/c1-2-15-12-13-18-20(14-15)22(23)19-11-7-6-10-17(19)21(18)16-8-4-3-5-9-16;1-2(3)4/h3-14,23H,2H2,1H3;1H3,(H,3,4)
InChIKeyFUMQWRWJWMSWMH-UHFFFAOYSA-N
MW358.44 g/mol
LogP6.02
Rot. Bonds2

About acetic acid;2-ethyl-10-phenylanthracen-9-ol

acetic acid;2-ethyl-10-phenylanthracen-9-ol (PubChem CID 71405476) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is acetic acid;2-ethyl-10-phenylanthracen-9-ol.

Molecular Properties

Compound Nameacetic acid;2-ethyl-10-phenylanthracen-9-ol
PubChem CID71405476
Molecular FormulaC24H22O3
Molecular Weight358.44 g/mol
Exact Mass358.16
IUPAC Nameacetic acid;2-ethyl-10-phenylanthracen-9-ol
SMILESCC(=O)O.CCc1ccc2c(-c3ccccc3)c3ccccc3c(O)c2c1
InChIInChI=1S/C22H18O.C2H4O2/c1-2-15-12-13-18-20(14-15)22(23)19-11-7-6-10-17(19)21(18)16-8-4-3-5-9-16;1-2(3)4/h3-14,23H,2H2,1H3;1H3,(H,3,4)
InChIKeyFUMQWRWJWMSWMH-UHFFFAOYSA-N
XLogP6.02
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500358.44
LogP ≤ 56.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze acetic acid;2-ethyl-10-phenylanthracen-9-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-ethyl-10-phenylanthracen-9-ol?
The IUPAC name of acetic acid;2-ethyl-10-phenylanthracen-9-ol (CID 71405476) is acetic acid;2-ethyl-10-phenylanthracen-9-ol.
What is the SMILES notation for acetic acid;2-ethyl-10-phenylanthracen-9-ol?
The canonical SMILES for acetic acid;2-ethyl-10-phenylanthracen-9-ol is CC(=O)O.CCc1ccc2c(-c3ccccc3)c3ccccc3c(O)c2c1.
What is the InChIKey of acetic acid;2-ethyl-10-phenylanthracen-9-ol?
The InChIKey is FUMQWRWJWMSWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O.C2H4O2/c1-2-15-12-13-18-20(14-15)22(23)19-11-7-6-10-17(19)21(18)16-8-4-3-5-9-16;1-2(3)4/h3-14,23H,2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-ethyl-10-phenylanthracen-9-ol?
acetic acid;2-ethyl-10-phenylanthracen-9-ol has a molecular weight of 358.44 g/mol, XLogP of 6.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethyl-10-phenylanthracen-9-ol is sourced from PubChem (CID 71405476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).