C53H44 — CID 145010127
2-ethyl-6,12-diphenyl-8-prop-1-en-2-yl-5,11-bis(4-prop-1-en-2-ylphenyl)tetracene (PubChem CID 145010127) has the molecular formula C53H44 and a molecular weight of 680.93 g/mol. Its IUPAC name is 2-ethyl-6,12-diphenyl-8-prop-1-en-2-yl-5,11-bis(4-prop-1-en-2-ylphenyl)tetracene.
| Compound Name | 2-ethyl-6,12-diphenyl-8-prop-1-en-2-yl-5,11-bis(4-prop-1-en-2-ylphenyl)tetracene |
|---|---|
| PubChem CID | 145010127 |
| Molecular Formula | C53H44 |
| Molecular Weight | 680.93 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 2-ethyl-6,12-diphenyl-8-prop-1-en-2-yl-5,11-bis(4-prop-1-en-2-ylphenyl)tetracene |
| SMILES | C=C(C)c1ccc(-c2c3ccc(CC)cc3c(-c3ccccc3)c3c(-c4ccc(C(=C)C)cc4)c4ccc(C(=C)C)cc4c(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C53H44/c1-8-36-19-29-44-46(31-36)50(39-15-11-9-12-16-39)52-49(42-26-22-38(23-27-42)34(4)5)45-30-28-43(35(6)7)32-47(45)51(40-17-13-10-14-18-40)53(52)48(44)41-24-20-37(21-25-41)33(2)3/h9-32H,2,4,6,8H2,1,3,5,7H3 |
| InChIKey | IWDOZLMTKQKWCT-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.93 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|