About 10,10a-dihydroindeno[1,2-b]quinolin-11-one
10,10a-dihydroindeno[1,2-b]quinolin-11-one (PubChem CID 71408531) has the molecular formula C16H11NO
and a molecular weight of 233.27 g/mol. Its IUPAC name is 10,10a-dihydroindeno[1,2-b]quinolin-11-one.
Molecular Properties
| Compound Name | 10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| PubChem CID | 71408531 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| SMILES | O=C1c2ccccc2C2=Nc3ccccc3CC12 |
| InChI | InChI=1S/C16H11NO/c18-16-12-7-3-2-6-11(12)15-13(16)9-10-5-1-4-8-14(10)17-15/h1-8,13H,9H2 |
| InChIKey | MISGKVCDOCTKRA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10,10a-dihydroindeno[1,2-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The IUPAC name of 10,10a-dihydroindeno[1,2-b]quinolin-11-one (CID 71408531) is 10,10a-dihydroindeno[1,2-b]quinolin-11-one.
What is the SMILES notation for 10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The canonical SMILES for 10,10a-dihydroindeno[1,2-b]quinolin-11-one is O=C1c2ccccc2C2=Nc3ccccc3CC12.
What is the InChIKey of 10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The InChIKey is MISGKVCDOCTKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO/c18-16-12-7-3-2-6-11(12)15-13(16)9-10-5-1-4-8-14(10)17-15/h1-8,13H,9H2.
What are the key properties of 10,10a-dihydroindeno[1,2-b]quinolin-11-one?
10,10a-dihydroindeno[1,2-b]quinolin-11-one has a molecular weight of 233.27 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10a-dihydroindeno[1,2-b]quinolin-11-one is sourced from PubChem (CID 71408531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).