C16H11NO — CID 71408531
10,10a-dihydroindeno[1,2-b]quinolin-11-one (PubChem CID 71408531) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is 10,10a-dihydroindeno[1,2-b]quinolin-11-one.
| Compound Name | 10,10a-dihydroindeno[1,2-b]quinolin-11-one |
|---|---|
| PubChem CID | 71408531 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| SMILES | O=C1c2ccccc2C2=Nc3ccccc3CC12 |
| InChI | InChI=1S/C16H11NO/c18-16-12-7-3-2-6-11(12)15-13(16)9-10-5-1-4-8-14(10)17-15/h1-8,13H,9H2 |
| InChIKey | MISGKVCDOCTKRA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |