C9H7Br2NO2 — CID 71409205
(2,4-dibromophenyl) N-ethenylcarbamate (PubChem CID 71409205) has the molecular formula C9H7Br2NO2 and a molecular weight of 320.97 g/mol. Its IUPAC name is (2,4-dibromophenyl) N-ethenylcarbamate.
| Compound Name | (2,4-dibromophenyl) N-ethenylcarbamate |
|---|---|
| PubChem CID | 71409205 |
| Molecular Formula | C9H7Br2NO2 |
| Molecular Weight | 320.97 g/mol |
| Exact Mass | 318.88 |
| IUPAC Name | (2,4-dibromophenyl) N-ethenylcarbamate |
| SMILES | C=CNC(=O)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H7Br2NO2/c1-2-12-9(13)14-8-4-3-6(10)5-7(8)11/h2-5H,1H2,(H,12,13) |
| InChIKey | LSAHGOIFKRXNFV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.97 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |