C14H18S2 — CID 71412189
2-[3-(4-methylphenyl)but-2-enyl]-1,3-dithiolane (PubChem CID 71412189) has the molecular formula C14H18S2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)but-2-enyl]-1,3-dithiolane.
| Compound Name | 2-[3-(4-methylphenyl)but-2-enyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 71412189 |
| Molecular Formula | C14H18S2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[3-(4-methylphenyl)but-2-enyl]-1,3-dithiolane |
| SMILES | CC(=CCC1SCCS1)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18S2/c1-11-3-6-13(7-4-11)12(2)5-8-14-15-9-10-16-14/h3-7,14H,8-10H2,1-2H3 |
| InChIKey | MYAJOBGNFSZDCZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |