C13H24OSi — CID 71412248
cis-(2S,6R)-2-methyl-6-(3-trimethylsilylprop-2-enyl)cyclohexan-1-one (PubChem CID 71412248) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is cis-(2S,6R)-2-methyl-6-(3-trimethylsilylprop-2-enyl)cyclohexan-1-one.
| Compound Name | cis-(2S,6R)-2-methyl-6-(3-trimethylsilylprop-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 71412248 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | cis-(2S,6R)-2-methyl-6-(3-trimethylsilylprop-2-enyl)cyclohexan-1-one |
| SMILES | C[C@H]1CCC[C@H](CC=C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C13H24OSi/c1-11-7-5-8-12(13(11)14)9-6-10-15(2,3)4/h6,10-12H,5,7-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | SBJIBGPTXUGHIT-NWDGAFQWSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|