C14H22O6S — CID 71413836
(5-ethyl-1,3-dioxan-5-yl)methanol;4-methylbenzenesulfonic acid (PubChem CID 71413836) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is (5-ethyl-1,3-dioxan-5-yl)methanol;4-methylbenzenesulfonic acid.
| Compound Name | (5-ethyl-1,3-dioxan-5-yl)methanol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 71413836 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5-ethyl-1,3-dioxan-5-yl)methanol;4-methylbenzenesulfonic acid |
| SMILES | CCC1(CO)COCOC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C7H14O3/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-7(3-8)4-9-6-10-5-7/h2-5H,1H3,(H,8,9,10);8H,2-6H2,1H3 |
| InChIKey | LDGNGZHHEMUQAY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|