About 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal
2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal (PubChem CID 71414103) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal.
Molecular Properties
| Compound Name | 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal |
| PubChem CID | 71414103 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal |
| SMILES | CC(C=O)=CCCC1(C)OCCO1 |
| InChI | InChI=1S/C10H16O3/c1-9(8-11)4-3-5-10(2)12-6-7-13-10/h4,8H,3,5-7H2,1-2H3 |
| InChIKey | HLNSCECLAIWTQU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal?
The IUPAC name of 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal (CID 71414103) is 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal.
What is the SMILES notation for 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal?
The canonical SMILES for 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal is CC(C=O)=CCCC1(C)OCCO1.
What is the InChIKey of 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal?
The InChIKey is HLNSCECLAIWTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-9(8-11)4-3-5-10(2)12-6-7-13-10/h4,8H,3,5-7H2,1-2H3.
What are the key properties of 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal?
2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal has a molecular weight of 184.23 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-enal is sourced from PubChem (CID 71414103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).