C14H26O2 — CID 71418053
1-(2,2,6,6-tetramethylcyclohexyl)oxybutan-2-one (PubChem CID 71418053) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylcyclohexyl)oxybutan-2-one.
| Compound Name | 1-(2,2,6,6-tetramethylcyclohexyl)oxybutan-2-one |
|---|---|
| PubChem CID | 71418053 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-(2,2,6,6-tetramethylcyclohexyl)oxybutan-2-one |
| SMILES | CCC(=O)COC1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C14H26O2/c1-6-11(15)10-16-12-13(2,3)8-7-9-14(12,4)5/h12H,6-10H2,1-5H3 |
| InChIKey | KYKKOQODLQQCMT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |