C27H36OSi2 — CID 71420564
[dimethyl(2-phenylpropyl)silyl]oxy-(2,2-diphenylethyl)-dimethylsilane (PubChem CID 71420564) has the molecular formula C27H36OSi2 and a molecular weight of 432.76 g/mol. Its IUPAC name is [dimethyl(2-phenylpropyl)silyl]oxy-(2,2-diphenylethyl)-dimethylsilane.
| Compound Name | [dimethyl(2-phenylpropyl)silyl]oxy-(2,2-diphenylethyl)-dimethylsilane |
|---|---|
| PubChem CID | 71420564 |
| Molecular Formula | C27H36OSi2 |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [dimethyl(2-phenylpropyl)silyl]oxy-(2,2-diphenylethyl)-dimethylsilane |
| SMILES | CC(C[Si](C)(C)O[Si](C)(C)CC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36OSi2/c1-23(24-15-9-6-10-16-24)21-29(2,3)28-30(4,5)22-27(25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27H,21-22H2,1-5H3 |
| InChIKey | CVWDYKVEMWKVBM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|