C12H10F3IO3 — CID 71424190
4-[[2-iodo-5-(trifluoromethyl)phenyl]methoxy]but-2-enoic acid (PubChem CID 71424190) has the molecular formula C12H10F3IO3 and a molecular weight of 386.11 g/mol. Its IUPAC name is 4-[[2-iodo-5-(trifluoromethyl)phenyl]methoxy]but-2-enoic acid.
| Compound Name | 4-[[2-iodo-5-(trifluoromethyl)phenyl]methoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 71424190 |
| Molecular Formula | C12H10F3IO3 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 4-[[2-iodo-5-(trifluoromethyl)phenyl]methoxy]but-2-enoic acid |
| SMILES | O=C(O)C=CCOCc1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C12H10F3IO3/c13-12(14,15)9-3-4-10(16)8(6-9)7-19-5-1-2-11(17)18/h1-4,6H,5,7H2,(H,17,18) |
| InChIKey | VNCKWTHGINMOQJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|