About 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine
2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine (PubChem CID 71427811) has the molecular formula C21H15BrO2S
and a molecular weight of 411.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine |
| PubChem CID | 71427811 |
| Molecular Formula | C21H15BrO2S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine |
| SMILES | Brc1ccc(C2=CSc3cc(OCc4ccccc4)ccc3O2)cc1 |
| InChI | InChI=1S/C21H15BrO2S/c22-17-8-6-16(7-9-17)20-14-25-21-12-18(10-11-19(21)24-20)23-13-15-4-2-1-3-5-15/h1-12,14H,13H2 |
| InChIKey | PVKAKMYBDNVLIZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine?
The IUPAC name of 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine (CID 71427811) is 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine.
What is the SMILES notation for 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine?
The canonical SMILES for 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine is Brc1ccc(C2=CSc3cc(OCc4ccccc4)ccc3O2)cc1.
What is the InChIKey of 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine?
The InChIKey is PVKAKMYBDNVLIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrO2S/c22-17-8-6-16(7-9-17)20-14-25-21-12-18(10-11-19(21)24-20)23-13-15-4-2-1-3-5-15/h1-12,14H,13H2.
What are the key properties of 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine?
2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine has a molecular weight of 411.32 g/mol, XLogP of 6.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-6-phenylmethoxy-1,4-benzoxathiine is sourced from PubChem (CID 71427811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).