About bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine
bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine (PubChem CID 71427966) has the molecular formula C32H24N2O6
and a molecular weight of 532.55 g/mol. Its IUPAC name is bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine |
| PubChem CID | 71427966 |
| Molecular Formula | C32H24N2O6 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine |
| SMILES | O=C(O)c1cc2ccccc2cc1O.O=C(O)c1cc2ccccc2cc1O.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/2C11H8O3.C10H8N2/c2*12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*1-6,12H,(H,13,14);1-8H |
| InChIKey | DUHMCEKCGPOAMI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine?
The IUPAC name of bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine (CID 71427966) is bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine is O=C(O)c1cc2ccccc2cc1O.O=C(O)c1cc2ccccc2cc1O.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine?
The InChIKey is DUHMCEKCGPOAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H8O3.C10H8N2/c2*12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*1-6,12H,(H,13,14);1-8H.
What are the key properties of bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine?
bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine has a molecular weight of 532.55 g/mol, XLogP of 6.63, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxynaphthalene-2-carboxylic acid);4-pyridin-4-ylpyridine is sourced from PubChem (CID 71427966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).