C16H19ClO4S — CID 71430717
3-(2-chloro-6-phenylphenyl)propan-1-ol;methanesulfonic acid (PubChem CID 71430717) has the molecular formula C16H19ClO4S and a molecular weight of 342.84 g/mol. Its IUPAC name is 3-(2-chloro-6-phenylphenyl)propan-1-ol;methanesulfonic acid.
| Compound Name | 3-(2-chloro-6-phenylphenyl)propan-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 71430717 |
| Molecular Formula | C16H19ClO4S |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-(2-chloro-6-phenylphenyl)propan-1-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OCCCc1c(Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C15H15ClO.CH4O3S/c16-15-10-4-8-13(14(15)9-5-11-17)12-6-2-1-3-7-12;1-5(2,3)4/h1-4,6-8,10,17H,5,9,11H2;1H3,(H,2,3,4) |
| InChIKey | AXXJKNDOZFFPCE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|