About 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide
5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide (PubChem CID 71433170) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide.
Analyze 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide?
The IUPAC name of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide (CID 71433170) is 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide.
What is the SMILES notation for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide?
The canonical SMILES for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide is O=S1C=CC2=CNCCC21.
What is the InChIKey of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide?
The InChIKey is SPYLWRPCMJNNHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c9-10-4-2-6-5-8-3-1-7(6)10/h2,4-5,7-8H,1,3H2.
What are the key properties of 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide?
5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide has a molecular weight of 155.22 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,7a-tetrahydrothieno[3,2-c]pyridine 1-oxide is sourced from PubChem (CID 71433170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).