C26H32O7 — CID 71436697
2-[6-[4-(furan-3-yl)-4a-methyl-8-methylidene-2-oxo-4,5,6,7-tetrahydro-1aH-oxireno[2,3-d]isochromen-7-yl]-2,2,6-trimethyl-3-oxocyclohexyl]acetic acid (PubChem CID 71436697) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[6-[4-(furan-3-yl)-4a-methyl-8-methylidene-2-oxo-4,5,6,7-tetrahydro-1aH-oxireno[2,3-d]isochromen-7-yl]-2,2,6-trimethyl-3-oxocyclohexyl]acetic acid.
| Compound Name | 2-[6-[4-(furan-3-yl)-4a-methyl-8-methylidene-2-oxo-4,5,6,7-tetrahydro-1aH-oxireno[2,3-d]isochromen-7-yl]-2,2,6-trimethyl-3-oxocyclohexyl]acetic acid |
|---|---|
| PubChem CID | 71436697 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2-[6-[4-(furan-3-yl)-4a-methyl-8-methylidene-2-oxo-4,5,6,7-tetrahydro-1aH-oxireno[2,3-d]isochromen-7-yl]-2,2,6-trimethyl-3-oxocyclohexyl]acetic acid |
| SMILES | C=C1C(C2(C)CCC(=O)C(C)(C)C2CC(=O)O)CCC2(C)C(c3ccoc3)OC(=O)C3OC132 |
| InChI | InChI=1S/C26H32O7/c1-14-16(24(4)9-7-18(27)23(2,3)17(24)12-19(28)29)6-10-25(5)20(15-8-11-31-13-15)32-22(30)21-26(14,25)33-21/h8,11,13,16-17,20-21H,1,6-7,9-10,12H2,2-5H3,(H,28,29) |
| InChIKey | WUVVPKGOVSPUSJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|