C18H16N2O2S — CID 71442903
2-(3-benzoylphenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide (PubChem CID 71442903) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(3-benzoylphenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 71442903 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-(3-benzoylphenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1cccc(C(=O)c2ccccc2)c1)NC1=NCCS1 |
| InChI | InChI=1S/C18H16N2O2S/c21-16(20-18-19-9-10-23-18)12-13-5-4-8-15(11-13)17(22)14-6-2-1-3-7-14/h1-8,11H,9-10,12H2,(H,19,20,21) |
| InChIKey | RZXIYNJCCXYVSA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |