About (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene
(1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene (PubChem CID 71443158) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene |
| PubChem CID | 71443158 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene |
| SMILES | CSC1=CC2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C11H18S/c1-10(2)8-5-6-11(10,3)9(7-8)12-4/h7-8H,5-6H2,1-4H3/t8?,11-/m0/s1 |
| InChIKey | DBJJUQAZRVHYCU-LYNSQETBSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene?
The IUPAC name of (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene (CID 71443158) is (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene?
The canonical SMILES for (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene is CSC1=CC2CC[C@]1(C)C2(C)C.
What is the InChIKey of (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene?
The InChIKey is DBJJUQAZRVHYCU-LYNSQETBSA-N. The full InChI is InChI=1S/C11H18S/c1-10(2)8-5-6-11(10,3)9(7-8)12-4/h7-8H,5-6H2,1-4H3/t8?,11-/m0/s1.
What are the key properties of (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene?
(1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene has a molecular weight of 182.33 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,7,7-trimethyl-2-methylsulfanylbicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 71443158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).