C17H28Si — CID 122227576
trimethyl-[(1E,3Z)-4-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)buta-1,3-dienyl]silane (PubChem CID 122227576) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-4-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)buta-1,3-dienyl]silane.
| Compound Name | trimethyl-[(1E,3Z)-4-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)buta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 122227576 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | trimethyl-[(1E,3Z)-4-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)buta-1,3-dienyl]silane |
| SMILES | CC12CCC(C=C1/C=C\C=C\[Si](C)(C)C)C2(C)C |
| InChI | InChI=1S/C17H28Si/c1-16(2)14-10-11-17(16,3)15(13-14)9-7-8-12-18(4,5)6/h7-9,12-14H,10-11H2,1-6H3/b9-7-,12-8+ |
| InChIKey | WGZAGZDCRGLQHU-ZUQSVMQASA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|