C18H20O3 — CID 71443265
2-hydroperoxy-4-methyl-1,2-diphenylpentan-3-one (PubChem CID 71443265) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-hydroperoxy-4-methyl-1,2-diphenylpentan-3-one.
| Compound Name | 2-hydroperoxy-4-methyl-1,2-diphenylpentan-3-one |
|---|---|
| PubChem CID | 71443265 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-hydroperoxy-4-methyl-1,2-diphenylpentan-3-one |
| SMILES | CC(C)C(=O)C(Cc1ccccc1)(OO)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-14(2)17(19)18(21-20,16-11-7-4-8-12-16)13-15-9-5-3-6-10-15/h3-12,14,20H,13H2,1-2H3 |
| InChIKey | DMNDLXWSIVVGBL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|