C10H7Cl3N2O3 — CID 71443956
methyl 4-nitro-N-(1,2,2-trichloroethenyl)benzenecarboximidate (PubChem CID 71443956) has the molecular formula C10H7Cl3N2O3 and a molecular weight of 309.54 g/mol. Its IUPAC name is methyl 4-nitro-N-(1,2,2-trichloroethenyl)benzenecarboximidate.
| Compound Name | methyl 4-nitro-N-(1,2,2-trichloroethenyl)benzenecarboximidate |
|---|---|
| PubChem CID | 71443956 |
| Molecular Formula | C10H7Cl3N2O3 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | methyl 4-nitro-N-(1,2,2-trichloroethenyl)benzenecarboximidate |
| SMILES | COC(=NC(Cl)=C(Cl)Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H7Cl3N2O3/c1-18-10(14-9(13)8(11)12)6-2-4-7(5-3-6)15(16)17/h2-5H,1H3 |
| InChIKey | NYWVICXOSRLLGS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|