C8H4I3NO2 — CID 3671977
1-nitro-4-(1,2,2-triiodoethenyl)benzene (PubChem CID 3671977) has the molecular formula C8H4I3NO2 and a molecular weight of 526.84 g/mol. Its IUPAC name is 1-nitro-4-(1,2,2-triiodoethenyl)benzene.
| Compound Name | 1-nitro-4-(1,2,2-triiodoethenyl)benzene |
|---|---|
| PubChem CID | 3671977 |
| Molecular Formula | C8H4I3NO2 |
| Molecular Weight | 526.84 g/mol |
| Exact Mass | 526.74 |
| IUPAC Name | 1-nitro-4-(1,2,2-triiodoethenyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(C(I)=C(I)I)cc1 |
| InChI | InChI=1S/C8H4I3NO2/c9-7(8(10)11)5-1-3-6(4-2-5)12(13)14/h1-4H |
| InChIKey | YMYCFUWHZSYMEB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|