About S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate
S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate (PubChem CID 71444559) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate.
Molecular Properties
| Compound Name | S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate |
| PubChem CID | 71444559 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate |
| SMILES | Cc1ccccc1NC(=O)SCC(C)C |
| InChI | InChI=1S/C12H17NOS/c1-9(2)8-15-12(14)13-11-7-5-4-6-10(11)3/h4-7,9H,8H2,1-3H3,(H,13,14) |
| InChIKey | HSWPMKDZMOCMRW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate?
The IUPAC name of S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate (CID 71444559) is S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate.
What is the SMILES notation for S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate?
The canonical SMILES for S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate is Cc1ccccc1NC(=O)SCC(C)C.
What is the InChIKey of S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate?
The InChIKey is HSWPMKDZMOCMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-9(2)8-15-12(14)13-11-7-5-4-6-10(11)3/h4-7,9H,8H2,1-3H3,(H,13,14).
What are the key properties of S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate?
S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate has a molecular weight of 223.34 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methylpropyl) N-(2-methylphenyl)carbamothioate is sourced from PubChem (CID 71444559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).