C13H21ClN2O — CID 53262280
[1-(2-methylanilino)-1-oxopropan-2-yl]-propylazanium chloride (PubChem CID 53262280) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is [1-(2-methylanilino)-1-oxopropan-2-yl]-propylazanium chloride.
| Compound Name | [1-(2-methylanilino)-1-oxopropan-2-yl]-propylazanium chloride |
|---|---|
| PubChem CID | 53262280 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [1-(2-methylanilino)-1-oxopropan-2-yl]-propylazanium chloride |
| SMILES | CCC[NH2+]C(C)C(=O)Nc1ccccc1C.[Cl-] |
| InChI | InChI=1S/C13H20N2O.ClH/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2;/h5-8,11,14H,4,9H2,1-3H3,(H,15,16);1H |
| InChIKey | BJPJNTKRKALCPP-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |