C17H31N3O+2 — CID 8019164
2-[[(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl]azaniumyl]ethyl-dimethylazanium (PubChem CID 8019164) has the molecular formula C17H31N3O+2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-[[(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl]azaniumyl]ethyl-dimethylazanium.
| Compound Name | 2-[[(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl]azaniumyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8019164 |
| Molecular Formula | C17H31N3O+2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-[[(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl]azaniumyl]ethyl-dimethylazanium |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@H](C)[NH2+]CC[NH+](C)C |
| InChI | InChI=1S/C17H29N3O/c1-6-13(2)15-9-7-8-10-16(15)19-17(21)14(3)18-11-12-20(4)5/h7-10,13-14,18H,6,11-12H2,1-5H3,(H,19,21)/p+2/t13-,14+/m1/s1 |
| InChIKey | YRYHZTDMVWWJPM-KGLIPLIRSA-P |
| XLogP | 0.23 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |