C20H19NO3 — CID 71447614
7-(1-benzofuran-2-yl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one (PubChem CID 71447614) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 7-(1-benzofuran-2-yl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one.
| Compound Name | 7-(1-benzofuran-2-yl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 71447614 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 7-(1-benzofuran-2-yl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one |
| SMILES | CC(C)N1C(=O)COCc2cc(-c3cc4ccccc4o3)ccc21 |
| InChI | InChI=1S/C20H19NO3/c1-13(2)21-17-8-7-15(9-16(17)11-23-12-20(21)22)19-10-14-5-3-4-6-18(14)24-19/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | BKBJIAJUSLYAAP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |