C16H13ClFNO2 — CID 71728840
7-(3-chloro-4-fluorophenyl)-1-methyl-5H-4,1-benzoxazepin-2-one (PubChem CID 71728840) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is 7-(3-chloro-4-fluorophenyl)-1-methyl-5H-4,1-benzoxazepin-2-one.
| Compound Name | 7-(3-chloro-4-fluorophenyl)-1-methyl-5H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 71728840 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 7-(3-chloro-4-fluorophenyl)-1-methyl-5H-4,1-benzoxazepin-2-one |
| SMILES | CN1C(=O)COCc2cc(-c3ccc(F)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H13ClFNO2/c1-19-15-5-3-10(6-12(15)8-21-9-16(19)20)11-2-4-14(18)13(17)7-11/h2-7H,8-9H2,1H3 |
| InChIKey | GCTNXCGOSBYDKF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |