C16H12BrClFNO2 — CID 54538115
1-bromo-6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one (PubChem CID 54538115) has the molecular formula C16H12BrClFNO2 and a molecular weight of 384.63 g/mol. Its IUPAC name is 1-bromo-6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one.
| Compound Name | 1-bromo-6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 54538115 |
| Molecular Formula | C16H12BrClFNO2 |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 1-bromo-6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)N(Br)c2ccc(-c3ccc(F)c(Cl)c3)cc21 |
| InChI | InChI=1S/C16H12BrClFNO2/c1-16(2)11-7-9(10-3-5-13(19)12(18)8-10)4-6-14(11)20(17)15(21)22-16/h3-8H,1-2H3 |
| InChIKey | ZBFICWMEKVAAQN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|