C17H20ClFN4O — CID 174377605
6-(3-chloro-4-fluorophenyl)-2-N,4-N,4-N'-trimethyl-1,2-dihydro-3,1-benzoxazine-2,4,4-triamine (PubChem CID 174377605) has the molecular formula C17H20ClFN4O and a molecular weight of 350.83 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-2-N,4-N,4-N'-trimethyl-1,2-dihydro-3,1-benzoxazine-2,4,4-triamine.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-2-N,4-N,4-N'-trimethyl-1,2-dihydro-3,1-benzoxazine-2,4,4-triamine |
|---|---|
| PubChem CID | 174377605 |
| Molecular Formula | C17H20ClFN4O |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-2-N,4-N,4-N'-trimethyl-1,2-dihydro-3,1-benzoxazine-2,4,4-triamine |
| SMILES | CNC1Nc2ccc(-c3ccc(F)c(Cl)c3)cc2C(NC)(NC)O1 |
| InChI | InChI=1S/C17H20ClFN4O/c1-20-16-23-15-7-5-10(11-4-6-14(19)13(18)9-11)8-12(15)17(21-2,22-3)24-16/h4-9,16,20-23H,1-3H3 |
| InChIKey | VWCPXQQBXVCLHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|