C27H17Cl3FNO2 — CID 68864080
7-(3-chloro-4-fluorophenyl)-5,5-bis(4-chlorophenyl)-1H-4,1-benzoxazepin-2-one (PubChem CID 68864080) has the molecular formula C27H17Cl3FNO2 and a molecular weight of 512.80 g/mol. Its IUPAC name is 7-(3-chloro-4-fluorophenyl)-5,5-bis(4-chlorophenyl)-1H-4,1-benzoxazepin-2-one.
| Compound Name | 7-(3-chloro-4-fluorophenyl)-5,5-bis(4-chlorophenyl)-1H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 68864080 |
| Molecular Formula | C27H17Cl3FNO2 |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 7-(3-chloro-4-fluorophenyl)-5,5-bis(4-chlorophenyl)-1H-4,1-benzoxazepin-2-one |
| SMILES | O=C1COC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)c2cc(-c3ccc(F)c(Cl)c3)ccc2N1 |
| InChI | InChI=1S/C27H17Cl3FNO2/c28-20-7-3-18(4-8-20)27(19-5-9-21(29)10-6-19)22-13-16(17-1-11-24(31)23(30)14-17)2-12-25(22)32-26(33)15-34-27/h1-14H,15H2,(H,32,33) |
| InChIKey | GSWUCPFBSCLUIW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |