C24H15FN2O4 — CID 68865225
3-[5,5-bis(furan-3-yl)-2-oxo-1H-4,1-benzoxazepin-7-yl]-5-fluorobenzonitrile (PubChem CID 68865225) has the molecular formula C24H15FN2O4 and a molecular weight of 414.39 g/mol. Its IUPAC name is 3-[5,5-bis(furan-3-yl)-2-oxo-1H-4,1-benzoxazepin-7-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[5,5-bis(furan-3-yl)-2-oxo-1H-4,1-benzoxazepin-7-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 68865225 |
| Molecular Formula | C24H15FN2O4 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-[5,5-bis(furan-3-yl)-2-oxo-1H-4,1-benzoxazepin-7-yl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(-c2ccc3c(c2)C(c2ccoc2)(c2ccoc2)OCC(=O)N3)c1 |
| InChI | InChI=1S/C24H15FN2O4/c25-20-8-15(11-26)7-17(9-20)16-1-2-22-21(10-16)24(18-3-5-29-12-18,19-4-6-30-13-19)31-14-23(28)27-22/h1-10,12-13H,14H2,(H,27,28) |
| InChIKey | JNYGLAYLRBRGLR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |