C16H9ClF3NO3 — CID 5327774
7-chloro-5-[2-(furan-3-yl)ethynyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one (PubChem CID 5327774) has the molecular formula C16H9ClF3NO3 and a molecular weight of 355.70 g/mol. Its IUPAC name is 7-chloro-5-[2-(furan-3-yl)ethynyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one.
| Compound Name | 7-chloro-5-[2-(furan-3-yl)ethynyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 5327774 |
| Molecular Formula | C16H9ClF3NO3 |
| Molecular Weight | 355.70 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 7-chloro-5-[2-(furan-3-yl)ethynyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
| SMILES | O=C1COC(C#Cc2ccoc2)(C(F)(F)F)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C16H9ClF3NO3/c17-11-1-2-13-12(7-11)15(16(18,19)20,24-9-14(22)21-13)5-3-10-4-6-23-8-10/h1-2,4,6-8H,9H2,(H,21,22) |
| InChIKey | YCJGNCRQLJTPHJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|