C18H20FN5O — CID 174369020
3-fluoro-5-[2,4,4-tris(methylamino)-1,2-dihydro-3,1-benzoxazin-6-yl]benzonitrile (PubChem CID 174369020) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-fluoro-5-[2,4,4-tris(methylamino)-1,2-dihydro-3,1-benzoxazin-6-yl]benzonitrile.
| Compound Name | 3-fluoro-5-[2,4,4-tris(methylamino)-1,2-dihydro-3,1-benzoxazin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 174369020 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-fluoro-5-[2,4,4-tris(methylamino)-1,2-dihydro-3,1-benzoxazin-6-yl]benzonitrile |
| SMILES | CNC1Nc2ccc(-c3cc(F)cc(C#N)c3)cc2C(NC)(NC)O1 |
| InChI | InChI=1S/C18H20FN5O/c1-21-17-24-16-5-4-12(9-15(16)18(22-2,23-3)25-17)13-6-11(10-20)7-14(19)8-13/h4-9,17,21-24H,1-3H3 |
| InChIKey | XJGFHXFCOWZMKT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|