C18H22N4O5 — CID 71448790
N-[1-[1-(2-methoxyethylamino)-2-methyl-1-oxopropan-2-yl]pyrazol-4-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 71448790) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[1-[1-(2-methoxyethylamino)-2-methyl-1-oxopropan-2-yl]pyrazol-4-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[1-(2-methoxyethylamino)-2-methyl-1-oxopropan-2-yl]pyrazol-4-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 71448790 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[1-[1-(2-methoxyethylamino)-2-methyl-1-oxopropan-2-yl]pyrazol-4-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCNC(=O)C(C)(C)n1cc(NC(=O)c2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C18H22N4O5/c1-18(2,17(24)19-6-7-25-3)22-10-13(9-20-22)21-16(23)12-4-5-14-15(8-12)27-11-26-14/h4-5,8-10H,6-7,11H2,1-3H3,(H,19,24)(H,21,23) |
| InChIKey | HCJPZOHNMVZCDS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|