C18H18IN5O6 — CID 71449139
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[7-[(3-iodophenyl)methylamino]-5-nitroimidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol (PubChem CID 71449139) has the molecular formula C18H18IN5O6 and a molecular weight of 527.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[7-[(3-iodophenyl)methylamino]-5-nitroimidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[7-[(3-iodophenyl)methylamino]-5-nitroimidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 71449139 |
| Molecular Formula | C18H18IN5O6 |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[7-[(3-iodophenyl)methylamino]-5-nitroimidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1cc(NCc2cccc(I)c2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C18H18IN5O6/c19-10-3-1-2-9(4-10)6-20-11-5-13(24(28)29)22-17-14(11)21-8-23(17)18-16(27)15(26)12(7-25)30-18/h1-5,8,12,15-16,18,25-27H,6-7H2,(H,20,22)/t12-,15-,16-,18-/m1/s1 |
| InChIKey | BMWATIVARSTKRP-HALQFCHDSA-N |
| XLogP | 1.17 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|