C32H44N2O4 — CID 71450066
N-(3,5-dimethyl-1-adamantyl)-4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butanamide (PubChem CID 71450066) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-adamantyl)-4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butanamide.
| Compound Name | N-(3,5-dimethyl-1-adamantyl)-4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butanamide |
|---|---|
| PubChem CID | 71450066 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | N-(3,5-dimethyl-1-adamantyl)-4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butanamide |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(CCCC(=O)NC13CC4CC(C)(CC(C)(C4)C1)C3)C2 |
| InChI | InChI=1S/C32H44N2O4/c1-29-14-21-15-30(2,18-29)20-31(16-21,19-29)33-26(36)5-4-11-34-12-10-32-9-8-23(35)13-25(32)38-28-24(37-3)7-6-22(17-34)27(28)32/h6-9,21,23,25,35H,4-5,10-20H2,1-3H3,(H,33,36)/t21?,23-,25-,29?,30?,31?,32-/m0/s1 |
| InChIKey | XLKMPUKWYIFXKF-GRVLVFFXSA-N |
| XLogP | 4.87 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|