C19H15N5 — CID 71450628
2-amino-1-(1H-benzimidazol-2-ylmethyl)-5-phenylpyrrole-3-carbonitrile (PubChem CID 71450628) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-amino-1-(1H-benzimidazol-2-ylmethyl)-5-phenylpyrrole-3-carbonitrile.
| Compound Name | 2-amino-1-(1H-benzimidazol-2-ylmethyl)-5-phenylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 71450628 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-amino-1-(1H-benzimidazol-2-ylmethyl)-5-phenylpyrrole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)n(Cc2nc3ccccc3[nH]2)c1N |
| InChI | InChI=1S/C19H15N5/c20-11-14-10-17(13-6-2-1-3-7-13)24(19(14)21)12-18-22-15-8-4-5-9-16(15)23-18/h1-10H,12,21H2,(H,22,23) |
| InChIKey | QLQQXNCULFMERS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |