C27H27BrN2O6 — CID 71452459
[[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-bromobenzoate (PubChem CID 71452459) has the molecular formula C27H27BrN2O6 and a molecular weight of 555.43 g/mol. Its IUPAC name is [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-bromobenzoate.
| Compound Name | [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-bromobenzoate |
|---|---|
| PubChem CID | 71452459 |
| Molecular Formula | C27H27BrN2O6 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-bromobenzoate |
| SMILES | COc1cc(C2CC(=NOC(=O)c3ccc(Br)cc3)CC(c3ccc(O)c(OC)c3)N2C)ccc1O |
| InChI | InChI=1S/C27H27BrN2O6/c1-30-21(17-6-10-23(31)25(12-17)34-2)14-20(29-36-27(33)16-4-8-19(28)9-5-16)15-22(30)18-7-11-24(32)26(13-18)35-3/h4-13,21-22,31-32H,14-15H2,1-3H3 |
| InChIKey | VXVCIYQSYUCROE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|