C28H30N2O7 — CID 71463140
[[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-methoxybenzoate (PubChem CID 71463140) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-methoxybenzoate.
| Compound Name | [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-methoxybenzoate |
|---|---|
| PubChem CID | 71463140 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [[2,6-bis(4-hydroxy-3-methoxyphenyl)-1-methylpiperidin-4-ylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C2CC(c3ccc(O)c(OC)c3)N(C)C(c3ccc(O)c(OC)c3)C2)cc1 |
| InChI | InChI=1S/C28H30N2O7/c1-30-22(18-7-11-24(31)26(13-18)35-3)15-20(16-23(30)19-8-12-25(32)27(14-19)36-4)29-37-28(33)17-5-9-21(34-2)10-6-17/h5-14,22-23,31-32H,15-16H2,1-4H3 |
| InChIKey | WGXVNPQKDXYIRU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|