C12H14BrClN2O2S — CID 71452957
methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-(2-chlorophenyl)prop-2-enoate;hydrobromide (PubChem CID 71452957) has the molecular formula C12H14BrClN2O2S and a molecular weight of 365.68 g/mol. Its IUPAC name is methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-(2-chlorophenyl)prop-2-enoate;hydrobromide.
| Compound Name | methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-(2-chlorophenyl)prop-2-enoate;hydrobromide |
|---|---|
| PubChem CID | 71452957 |
| Molecular Formula | C12H14BrClN2O2S |
| Molecular Weight | 365.68 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | methyl (Z)-2-(carbamimidoylsulfanylmethyl)-3-(2-chlorophenyl)prop-2-enoate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SC/C(=C\c1ccccc1Cl)C(=O)OC |
| InChI | InChI=1S/C12H13ClN2O2S.BrH/c1-17-11(16)9(7-18-12(14)15)6-8-4-2-3-5-10(8)13;/h2-6H,7H2,1H3,(H3,14,15);1H/b9-6+; |
| InChIKey | YUQHMAHQBRDNML-MLBSPLJJSA-N |
| XLogP | 3.10 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|