C16H17ClN2O4S — CID 71451134
methyl (Z)-3-(2-chlorophenyl)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]prop-2-enoate (PubChem CID 71451134) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is methyl (Z)-3-(2-chlorophenyl)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-(2-chlorophenyl)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 71451134 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | methyl (Z)-3-(2-chlorophenyl)-2-[(N,N'-diacetylcarbamimidoyl)sulfanylmethyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccccc1Cl)CS/C(=N/C(C)=O)NC(C)=O |
| InChI | InChI=1S/C16H17ClN2O4S/c1-10(20)18-16(19-11(2)21)24-9-13(15(22)23-3)8-12-6-4-5-7-14(12)17/h4-8H,9H2,1-3H3,(H,18,19,20,21)/b13-8+ |
| InChIKey | QHKVRMNVPNNUKZ-MDWZMJQESA-N |
| XLogP | 2.67 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|