C32H39N5O2S — CID 71453160
3-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 71453160) has the molecular formula C32H39N5O2S and a molecular weight of 557.76 g/mol. Its IUPAC name is 3-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 71453160 |
| Molecular Formula | C32H39N5O2S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 3-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CCN(CCCCNc1c2c(nc3ccccc13)CCCC2)CCC(=O)Nc1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C32H39N5O2S/c1-3-37(21-18-30(38)36-32-35-29(22-40-32)23-14-16-24(39-2)17-15-23)20-9-8-19-33-31-25-10-4-6-12-27(25)34-28-13-7-5-11-26(28)31/h4,6,10,12,14-17,22H,3,5,7-9,11,13,18-21H2,1-2H3,(H,33,34)(H,35,36,38) |
| InChIKey | BQDAZAMCOASTTO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|