C20H22BrN3O3S — CID 71455436
N-[5-(5-bromoindol-1-yl)sulfonyl-2-methoxyphenyl]piperidin-4-amine (PubChem CID 71455436) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[5-(5-bromoindol-1-yl)sulfonyl-2-methoxyphenyl]piperidin-4-amine.
| Compound Name | N-[5-(5-bromoindol-1-yl)sulfonyl-2-methoxyphenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 71455436 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[5-(5-bromoindol-1-yl)sulfonyl-2-methoxyphenyl]piperidin-4-amine |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3cc(Br)ccc32)cc1NC1CCNCC1 |
| InChI | InChI=1S/C20H22BrN3O3S/c1-27-20-5-3-17(13-18(20)23-16-6-9-22-10-7-16)28(25,26)24-11-8-14-12-15(21)2-4-19(14)24/h2-5,8,11-13,16,22-23H,6-7,9-10H2,1H3 |
| InChIKey | PPVLVFAETPMXHO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |