C21H20O6 — CID 71456588
1,4,5-trihydroxy-2-methyl-3-(4-methylpentanoyl)anthracene-9,10-dione (PubChem CID 71456588) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1,4,5-trihydroxy-2-methyl-3-(4-methylpentanoyl)anthracene-9,10-dione.
| Compound Name | 1,4,5-trihydroxy-2-methyl-3-(4-methylpentanoyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 71456588 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1,4,5-trihydroxy-2-methyl-3-(4-methylpentanoyl)anthracene-9,10-dione |
| SMILES | Cc1c(O)c2c(c(O)c1C(=O)CCC(C)C)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C21H20O6/c1-9(2)7-8-13(23)14-10(3)18(24)16-17(20(14)26)21(27)15-11(19(16)25)5-4-6-12(15)22/h4-6,9,22,24,26H,7-8H2,1-3H3 |
| InChIKey | PKWTYZNHEWSFNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|