C22H26ClN3O3S — CID 71457264
N-[5-(5-chloro-3-methylindol-1-yl)sulfonyl-2-methoxyphenyl]-1-methylpiperidin-4-amine (PubChem CID 71457264) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is N-[5-(5-chloro-3-methylindol-1-yl)sulfonyl-2-methoxyphenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[5-(5-chloro-3-methylindol-1-yl)sulfonyl-2-methoxyphenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 71457264 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[5-(5-chloro-3-methylindol-1-yl)sulfonyl-2-methoxyphenyl]-1-methylpiperidin-4-amine |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C)c3cc(Cl)ccc32)cc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C22H26ClN3O3S/c1-15-14-26(21-6-4-16(23)12-19(15)21)30(27,28)18-5-7-22(29-3)20(13-18)24-17-8-10-25(2)11-9-17/h4-7,12-14,17,24H,8-11H2,1-3H3 |
| InChIKey | ZPUAIXYROPYWKA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |