C21H20O5 — CID 71458451
1,8-dihydroxy-3-methyl-2-(4-methylpentanoyl)anthracene-9,10-dione (PubChem CID 71458451) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1,8-dihydroxy-3-methyl-2-(4-methylpentanoyl)anthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-3-methyl-2-(4-methylpentanoyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 71458451 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1,8-dihydroxy-3-methyl-2-(4-methylpentanoyl)anthracene-9,10-dione |
| SMILES | Cc1cc2c(c(O)c1C(=O)CCC(C)C)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C21H20O5/c1-10(2)7-8-15(23)16-11(3)9-13-18(20(16)25)21(26)17-12(19(13)24)5-4-6-14(17)22/h4-6,9-10,22,25H,7-8H2,1-3H3 |
| InChIKey | OAWSKJJZFQTYDQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|