C15H22O2 — CID 71458646
2-[(2S)-4-[(2R)-3,3-dimethyloxiran-2-yl]butan-2-yl]-5-methylphenol (PubChem CID 71458646) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[(2S)-4-[(2R)-3,3-dimethyloxiran-2-yl]butan-2-yl]-5-methylphenol.
| Compound Name | 2-[(2S)-4-[(2R)-3,3-dimethyloxiran-2-yl]butan-2-yl]-5-methylphenol |
|---|---|
| PubChem CID | 71458646 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-[(2S)-4-[(2R)-3,3-dimethyloxiran-2-yl]butan-2-yl]-5-methylphenol |
| SMILES | Cc1ccc([C@@H](C)CC[C@H]2OC2(C)C)c(O)c1 |
| InChI | InChI=1S/C15H22O2/c1-10-5-7-12(13(16)9-10)11(2)6-8-14-15(3,4)17-14/h5,7,9,11,14,16H,6,8H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | UQPUIYSLIAOKCT-SMDDNHRTSA-N |
| XLogP | 3.76 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|